C25H32O3Si — CID 11189032
(1R,4aR,5S,7S,7aR)-5-[tert-butyl(diphenyl)silyl]oxy-7-methyl-1,4a,5,6,7,7a-hexahydrocyclopenta[c]pyran-1-ol (PubChem CID 11189032) has the molecular formula C25H32O3Si and a molecular weight of 408.61 g/mol. Its IUPAC name is (1R,4aR,5S,7S,7aR)-5-[tert-butyl(diphenyl)silyl]oxy-7-methyl-1,4a,5,6,7,7a-hexahydrocyclopenta[c]pyran-1-ol.
| Compound Name | (1R,4aR,5S,7S,7aR)-5-[tert-butyl(diphenyl)silyl]oxy-7-methyl-1,4a,5,6,7,7a-hexahydrocyclopenta[c]pyran-1-ol |
|---|---|
| PubChem CID | 11189032 |
| Molecular Formula | C25H32O3Si |
| Molecular Weight | 408.61 g/mol |
| Exact Mass | 408.21 |
| IUPAC Name | (1R,4aR,5S,7S,7aR)-5-[tert-butyl(diphenyl)silyl]oxy-7-methyl-1,4a,5,6,7,7a-hexahydrocyclopenta[c]pyran-1-ol |
| SMILES | C[C@H]1C[C@H](O[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)[C@@H]2C=CO[C@@H](O)[C@@H]21 |
| InChI | InChI=1S/C25H32O3Si/c1-18-17-22(21-15-16-27-24(26)23(18)21)28-29(25(2,3)4,19-11-7-5-8-12-19)20-13-9-6-10-14-20/h5-16,18,21-24,26H,17H2,1-4H3/t18-,21-,22-,23+,24+/m0/s1 |
| InChIKey | FSGKKDOMGDYRJG-OTGYPNLISA-N |
| XLogP | 4.07 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.61 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|