C26H46O2Si — CID 11189301
(1S,2R,4S,6S,7R)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-nonyltricyclo[5.2.1.02,6]dec-8-en-3-one (PubChem CID 11189301) has the molecular formula C26H46O2Si and a molecular weight of 418.74 g/mol. Its IUPAC name is (1S,2R,4S,6S,7R)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-nonyltricyclo[5.2.1.02,6]dec-8-en-3-one.
| Compound Name | (1S,2R,4S,6S,7R)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-nonyltricyclo[5.2.1.02,6]dec-8-en-3-one |
|---|---|
| PubChem CID | 11189301 |
| Molecular Formula | C26H46O2Si |
| Molecular Weight | 418.74 g/mol |
| Exact Mass | 418.33 |
| IUPAC Name | (1S,2R,4S,6S,7R)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-nonyltricyclo[5.2.1.02,6]dec-8-en-3-one |
| SMILES | CCCCCCCCC[C@@]1(CO[Si](C)(C)C(C)(C)C)C[C@@H]2[C@H](C1=O)[C@@H]1C=C[C@H]2C1 |
| InChI | InChI=1S/C26H46O2Si/c1-7-8-9-10-11-12-13-16-26(19-28-29(5,6)25(2,3)4)18-22-20-14-15-21(17-20)23(22)24(26)27/h14-15,20-23H,7-13,16-19H2,1-6H3/t20-,21+,22-,23+,26-/m0/s1 |
| InChIKey | FIYGJVQMKUZPPU-AIDKGEFFSA-N |
| XLogP | 7.55 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.74 |
| LogP ≤ 5 | 7.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|