C17H20N6S — CID 111893501
1-[(6-imidazol-1-yl-3-pyridinyl)methyl]-2-methyl-3-[(3-methylthiophen-2-yl)methyl]guanidine (PubChem CID 111893501) has the molecular formula C17H20N6S and a molecular weight of 340.46 g/mol. Its IUPAC name is 1-[(6-imidazol-1-yl-3-pyridinyl)methyl]-2-methyl-3-[(3-methylthiophen-2-yl)methyl]guanidine.
| Compound Name | 1-[(6-imidazol-1-yl-3-pyridinyl)methyl]-2-methyl-3-[(3-methylthiophen-2-yl)methyl]guanidine |
|---|---|
| PubChem CID | 111893501 |
| Molecular Formula | C17H20N6S |
| Molecular Weight | 340.46 g/mol |
| Exact Mass | 340.15 |
| IUPAC Name | 1-[(6-imidazol-1-yl-3-pyridinyl)methyl]-2-methyl-3-[(3-methylthiophen-2-yl)methyl]guanidine |
| SMILES | C/N=C(/NCc1ccc(-n2ccnc2)nc1)NCc1sccc1C |
| InChI | InChI=1S/C17H20N6S/c1-13-5-8-24-15(13)11-22-17(18-2)21-10-14-3-4-16(20-9-14)23-7-6-19-12-23/h3-9,12H,10-11H2,1-2H3,(H2,18,21,22) |
| InChIKey | UVKRWPHJYVYTLC-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 67.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.46 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|