C24H26ClN3O2 — CID 11189426
1-[6-chloro-1-(3-hydroxyphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-2-piperidin-4-ylethanone (PubChem CID 11189426) has the molecular formula C24H26ClN3O2 and a molecular weight of 423.94 g/mol. Its IUPAC name is 1-[6-chloro-1-(3-hydroxyphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-2-piperidin-4-ylethanone.
| Compound Name | 1-[6-chloro-1-(3-hydroxyphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-2-piperidin-4-ylethanone |
|---|---|
| PubChem CID | 11189426 |
| Molecular Formula | C24H26ClN3O2 |
| Molecular Weight | 423.94 g/mol |
| Exact Mass | 423.17 |
| IUPAC Name | 1-[6-chloro-1-(3-hydroxyphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-2-piperidin-4-ylethanone |
| SMILES | O=C(CC1CCNCC1)N1CCc2c([nH]c3ccc(Cl)cc23)C1c1cccc(O)c1 |
| InChI | InChI=1S/C24H26ClN3O2/c25-17-4-5-21-20(14-17)19-8-11-28(22(30)12-15-6-9-26-10-7-15)24(23(19)27-21)16-2-1-3-18(29)13-16/h1-5,13-15,24,26-27,29H,6-12H2 |
| InChIKey | UMURMRMRPSZQBP-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 68.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.94 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|