C16H27IN4O3 — CID 111894338
2-[4-[2-[[N-(2-ethoxyethyl)-N'-methylcarbamimidoyl]amino]ethyl]phenoxy]acetamide;hydroiodide (PubChem CID 111894338) has the molecular formula C16H27IN4O3 and a molecular weight of 450.32 g/mol. Its IUPAC name is 2-[4-[2-[[N-(2-ethoxyethyl)-N'-methylcarbamimidoyl]amino]ethyl]phenoxy]acetamide;hydroiodide.
| Compound Name | 2-[4-[2-[[N-(2-ethoxyethyl)-N'-methylcarbamimidoyl]amino]ethyl]phenoxy]acetamide;hydroiodide |
|---|---|
| PubChem CID | 111894338 |
| Molecular Formula | C16H27IN4O3 |
| Molecular Weight | 450.32 g/mol |
| Exact Mass | 450.11 |
| IUPAC Name | 2-[4-[2-[[N-(2-ethoxyethyl)-N'-methylcarbamimidoyl]amino]ethyl]phenoxy]acetamide;hydroiodide |
| SMILES | CCOCCN/C(=N\C)NCCc1ccc(OCC(N)=O)cc1.I |
| InChI | InChI=1S/C16H26N4O3.HI/c1-3-22-11-10-20-16(18-2)19-9-8-13-4-6-14(7-5-13)23-12-15(17)21;/h4-7H,3,8-12H2,1-2H3,(H2,17,21)(H2,18,19,20);1H |
| InChIKey | GKJKTGRTYVEFLB-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 97.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.32 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|