C27H43N3O — CID 11189482
4-[4-(4-propylpiperazin-1-yl)-3-(3,3,5,5-tetramethylcyclohexen-1-yl)phenyl]morpholine (PubChem CID 11189482) has the molecular formula C27H43N3O and a molecular weight of 425.66 g/mol. Its IUPAC name is 4-[4-(4-propylpiperazin-1-yl)-3-(3,3,5,5-tetramethylcyclohexen-1-yl)phenyl]morpholine.
| Compound Name | 4-[4-(4-propylpiperazin-1-yl)-3-(3,3,5,5-tetramethylcyclohexen-1-yl)phenyl]morpholine |
|---|---|
| PubChem CID | 11189482 |
| Molecular Formula | C27H43N3O |
| Molecular Weight | 425.66 g/mol |
| Exact Mass | 425.34 |
| IUPAC Name | 4-[4-(4-propylpiperazin-1-yl)-3-(3,3,5,5-tetramethylcyclohexen-1-yl)phenyl]morpholine |
| SMILES | CCCN1CCN(c2ccc(N3CCOCC3)cc2C2=CC(C)(C)CC(C)(C)C2)CC1 |
| InChI | InChI=1S/C27H43N3O/c1-6-9-28-10-12-30(13-11-28)25-8-7-23(29-14-16-31-17-15-29)18-24(25)22-19-26(2,3)21-27(4,5)20-22/h7-8,18-19H,6,9-17,20-21H2,1-5H3 |
| InChIKey | GJVTVWAPHHBLFR-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 18.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.66 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|