C26H40O3Si — CID 11189574
(2R,4aS,6R,7R,9aR)-2-prop-2-enyl-6-[(Z)-5-tri(propan-2-yl)silylpent-2-en-4-ynyl]-4a,6,7,9a-tetrahydro-2H-pyrano[3,2-b]oxepin-7-ol (PubChem CID 11189574) has the molecular formula C26H40O3Si and a molecular weight of 428.69 g/mol. Its IUPAC name is (2R,4aS,6R,7R,9aR)-2-prop-2-enyl-6-[(Z)-5-tri(propan-2-yl)silylpent-2-en-4-ynyl]-4a,6,7,9a-tetrahydro-2H-pyrano[3,2-b]oxepin-7-ol.
| Compound Name | (2R,4aS,6R,7R,9aR)-2-prop-2-enyl-6-[(Z)-5-tri(propan-2-yl)silylpent-2-en-4-ynyl]-4a,6,7,9a-tetrahydro-2H-pyrano[3,2-b]oxepin-7-ol |
|---|---|
| PubChem CID | 11189574 |
| Molecular Formula | C26H40O3Si |
| Molecular Weight | 428.69 g/mol |
| Exact Mass | 428.27 |
| IUPAC Name | (2R,4aS,6R,7R,9aR)-2-prop-2-enyl-6-[(Z)-5-tri(propan-2-yl)silylpent-2-en-4-ynyl]-4a,6,7,9a-tetrahydro-2H-pyrano[3,2-b]oxepin-7-ol |
| SMILES | C=CC[C@@H]1C=C[C@@H]2O[C@H](C/C=C\C#C[Si](C(C)C)(C(C)C)C(C)C)[C@H](O)C=C[C@H]2O1 |
| InChI | InChI=1S/C26H40O3Si/c1-8-12-22-14-16-26-25(28-22)17-15-23(27)24(29-26)13-10-9-11-18-30(19(2)3,20(4)5)21(6)7/h8-10,14-17,19-27H,1,12-13H2,2-7H3/b10-9-/t22-,23-,24-,25-,26+/m1/s1 |
| InChIKey | DNPFUPGVKASKOM-VDZLFDDYSA-N |
| XLogP | 5.74 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.69 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|