C26H23FN2OS — CID 11189622
(R)-1-benzothiophen-3-yl-[(5S)-1-(4-fluorophenyl)-4,4a,5,6,7,8-hexahydrobenzo[f]indazol-5-yl]methanol (PubChem CID 11189622) has the molecular formula C26H23FN2OS and a molecular weight of 430.55 g/mol. Its IUPAC name is (R)-1-benzothiophen-3-yl-[(5S)-1-(4-fluorophenyl)-4,4a,5,6,7,8-hexahydrobenzo[f]indazol-5-yl]methanol.
| Compound Name | (R)-1-benzothiophen-3-yl-[(5S)-1-(4-fluorophenyl)-4,4a,5,6,7,8-hexahydrobenzo[f]indazol-5-yl]methanol |
|---|---|
| PubChem CID | 11189622 |
| Molecular Formula | C26H23FN2OS |
| Molecular Weight | 430.55 g/mol |
| Exact Mass | 430.15 |
| IUPAC Name | (R)-1-benzothiophen-3-yl-[(5S)-1-(4-fluorophenyl)-4,4a,5,6,7,8-hexahydrobenzo[f]indazol-5-yl]methanol |
| SMILES | O[C@@H](c1csc2ccccc12)[C@H]1CCCC2=Cc3c(cnn3-c3ccc(F)cc3)CC21 |
| InChI | InChI=1S/C26H23FN2OS/c27-18-8-10-19(11-9-18)29-24-13-16-4-3-6-21(22(16)12-17(24)14-28-29)26(30)23-15-31-25-7-2-1-5-20(23)25/h1-2,5,7-11,13-15,21-22,26,30H,3-4,6,12H2/t21-,22?,26+/m0/s1 |
| InChIKey | DRXAIUKVRBMPHY-GNBZNTSPSA-N |
| XLogP | 6.32 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.55 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |