C25H41NO3Si — CID 11189651
tert-butyl (2R,4R,5S)-1-benzyl-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-ethenylpyrrolidine-2-carboxylate (PubChem CID 11189651) has the molecular formula C25H41NO3Si and a molecular weight of 431.69 g/mol. Its IUPAC name is tert-butyl (2R,4R,5S)-1-benzyl-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-ethenylpyrrolidine-2-carboxylate.
| Compound Name | tert-butyl (2R,4R,5S)-1-benzyl-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-ethenylpyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 11189651 |
| Molecular Formula | C25H41NO3Si |
| Molecular Weight | 431.69 g/mol |
| Exact Mass | 431.29 |
| IUPAC Name | tert-butyl (2R,4R,5S)-1-benzyl-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-ethenylpyrrolidine-2-carboxylate |
| SMILES | C=C[C@H]1[C@H](CO[Si](C)(C)C(C)(C)C)C[C@H](C(=O)OC(C)(C)C)N1Cc1ccccc1 |
| InChI | InChI=1S/C25H41NO3Si/c1-10-21-20(18-28-30(8,9)25(5,6)7)16-22(23(27)29-24(2,3)4)26(21)17-19-14-12-11-13-15-19/h10-15,20-22H,1,16-18H2,2-9H3/t20-,21-,22+/m0/s1 |
| InChIKey | UKLBFXXZBWHLHK-FDFHNCONSA-N |
| XLogP | 5.80 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.69 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|