C24H30ClN3 — CID 11189666
2-(2-chloro-4-methylphenyl)-7-heptan-4-yl-10-methyl-2,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene (PubChem CID 11189666) has the molecular formula C24H30ClN3 and a molecular weight of 395.98 g/mol. Its IUPAC name is 2-(2-chloro-4-methylphenyl)-7-heptan-4-yl-10-methyl-2,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene.
| Compound Name | 2-(2-chloro-4-methylphenyl)-7-heptan-4-yl-10-methyl-2,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene |
|---|---|
| PubChem CID | 11189666 |
| Molecular Formula | C24H30ClN3 |
| Molecular Weight | 395.98 g/mol |
| Exact Mass | 395.21 |
| IUPAC Name | 2-(2-chloro-4-methylphenyl)-7-heptan-4-yl-10-methyl-2,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene |
| SMILES | CCCC(CCC)N1CCc2cn(-c3ccc(C)cc3Cl)c3nc(C)cc1c23 |
| InChI | InChI=1S/C24H30ClN3/c1-5-7-19(8-6-2)27-12-11-18-15-28(21-10-9-16(3)13-20(21)25)24-23(18)22(27)14-17(4)26-24/h9-10,13-15,19H,5-8,11-12H2,1-4H3 |
| InChIKey | KZZYCCAWSHGKJQ-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.98 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |