C19H31IO3 — CID 11189722
(2S)-2-[(1R,3R,4aR,5R,8aS)-3-hydroxy-5-[(2R)-1-iodo-3-methylbutan-2-yl]-7-methyl-1,2,3,4,4a,5,6,8a-octahydronaphthalen-1-yl]propanoic acid (PubChem CID 11189722) has the molecular formula C19H31IO3 and a molecular weight of 434.36 g/mol. Its IUPAC name is (2S)-2-[(1R,3R,4aR,5R,8aS)-3-hydroxy-5-[(2R)-1-iodo-3-methylbutan-2-yl]-7-methyl-1,2,3,4,4a,5,6,8a-octahydronaphthalen-1-yl]propanoic acid.
| Compound Name | (2S)-2-[(1R,3R,4aR,5R,8aS)-3-hydroxy-5-[(2R)-1-iodo-3-methylbutan-2-yl]-7-methyl-1,2,3,4,4a,5,6,8a-octahydronaphthalen-1-yl]propanoic acid |
|---|---|
| PubChem CID | 11189722 |
| Molecular Formula | C19H31IO3 |
| Molecular Weight | 434.36 g/mol |
| Exact Mass | 434.13 |
| IUPAC Name | (2S)-2-[(1R,3R,4aR,5R,8aS)-3-hydroxy-5-[(2R)-1-iodo-3-methylbutan-2-yl]-7-methyl-1,2,3,4,4a,5,6,8a-octahydronaphthalen-1-yl]propanoic acid |
| SMILES | CC1=C[C@@H]2[C@H]([C@H](C)C(=O)O)C[C@H](O)C[C@@H]2[C@H]([C@H](CI)C(C)C)C1 |
| InChI | InChI=1S/C19H31IO3/c1-10(2)18(9-20)16-6-11(3)5-15-14(12(4)19(22)23)7-13(21)8-17(15)16/h5,10,12-18,21H,6-9H2,1-4H3,(H,22,23)/t12-,13-,14-,15+,16+,17-,18+/m0/s1 |
| InChIKey | WNSBXFFBORTIDJ-FPMLTQPBSA-N |
| XLogP | 4.38 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.36 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|