C18H21N5S — CID 111898501
2-methyl-1-[(5-methylthiophen-2-yl)methyl]-3-[(1-phenylpyrazol-4-yl)methyl]guanidine (PubChem CID 111898501) has the molecular formula C18H21N5S and a molecular weight of 339.47 g/mol. Its IUPAC name is 2-methyl-1-[(5-methylthiophen-2-yl)methyl]-3-[(1-phenylpyrazol-4-yl)methyl]guanidine.
| Compound Name | 2-methyl-1-[(5-methylthiophen-2-yl)methyl]-3-[(1-phenylpyrazol-4-yl)methyl]guanidine |
|---|---|
| PubChem CID | 111898501 |
| Molecular Formula | C18H21N5S |
| Molecular Weight | 339.47 g/mol |
| Exact Mass | 339.15 |
| IUPAC Name | 2-methyl-1-[(5-methylthiophen-2-yl)methyl]-3-[(1-phenylpyrazol-4-yl)methyl]guanidine |
| SMILES | C/N=C(/NCc1cnn(-c2ccccc2)c1)NCc1ccc(C)s1 |
| InChI | InChI=1S/C18H21N5S/c1-14-8-9-17(24-14)12-21-18(19-2)20-10-15-11-22-23(13-15)16-6-4-3-5-7-16/h3-9,11,13H,10,12H2,1-2H3,(H2,19,20,21) |
| InChIKey | FCXJRMVNWRIRJH-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 54.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.47 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|