C22H28ClN3OS2 — CID 11190153
N-[(9-amino-6-chloro-1,2,3,4-tetrahydroacridin-3-yl)methyl]-5-(dithiolan-3-yl)pentanamide (PubChem CID 11190153) has the molecular formula C22H28ClN3OS2 and a molecular weight of 450.07 g/mol. Its IUPAC name is N-[(9-amino-6-chloro-1,2,3,4-tetrahydroacridin-3-yl)methyl]-5-(dithiolan-3-yl)pentanamide.
| Compound Name | N-[(9-amino-6-chloro-1,2,3,4-tetrahydroacridin-3-yl)methyl]-5-(dithiolan-3-yl)pentanamide |
|---|---|
| PubChem CID | 11190153 |
| Molecular Formula | C22H28ClN3OS2 |
| Molecular Weight | 450.07 g/mol |
| Exact Mass | 449.14 |
| IUPAC Name | N-[(9-amino-6-chloro-1,2,3,4-tetrahydroacridin-3-yl)methyl]-5-(dithiolan-3-yl)pentanamide |
| SMILES | Nc1c2c(nc3cc(Cl)ccc13)CC(CNC(=O)CCCCC1CCSS1)CC2 |
| InChI | InChI=1S/C22H28ClN3OS2/c23-15-6-8-18-20(12-15)26-19-11-14(5-7-17(19)22(18)24)13-25-21(27)4-2-1-3-16-9-10-28-29-16/h6,8,12,14,16H,1-5,7,9-11,13H2,(H2,24,26)(H,25,27) |
| InChIKey | YNUALVMKORREBG-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.07 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|