C21H21F3N2O4S — CID 11190251
3-(4-methylphenyl)sulfonyl-6,7,8,9-tetrahydrobenzo[e]indol-8-amine;2,2,2-trifluoroacetic acid (PubChem CID 11190251) has the molecular formula C21H21F3N2O4S and a molecular weight of 454.47 g/mol. Its IUPAC name is 3-(4-methylphenyl)sulfonyl-6,7,8,9-tetrahydrobenzo[e]indol-8-amine;2,2,2-trifluoroacetic acid.
| Compound Name | 3-(4-methylphenyl)sulfonyl-6,7,8,9-tetrahydrobenzo[e]indol-8-amine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 11190251 |
| Molecular Formula | C21H21F3N2O4S |
| Molecular Weight | 454.47 g/mol |
| Exact Mass | 454.12 |
| IUPAC Name | 3-(4-methylphenyl)sulfonyl-6,7,8,9-tetrahydrobenzo[e]indol-8-amine;2,2,2-trifluoroacetic acid |
| SMILES | Cc1ccc(S(=O)(=O)n2ccc3c4c(ccc32)CCC(N)C4)cc1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C19H20N2O2S.C2HF3O2/c1-13-2-7-16(8-3-13)24(22,23)21-11-10-17-18-12-15(20)6-4-14(18)5-9-19(17)21;3-2(4,5)1(6)7/h2-3,5,7-11,15H,4,6,12,20H2,1H3;(H,6,7) |
| InChIKey | AERYVXIDEDINGJ-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 102.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.47 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |