C25H50O3Si2 — CID 11190268
(4S,6S,8R)-6-[tert-butyl(dimethyl)silyl]oxy-8-tri(propan-2-yl)silyloxydec-1-en-9-yn-4-ol (PubChem CID 11190268) has the molecular formula C25H50O3Si2 and a molecular weight of 454.84 g/mol. Its IUPAC name is (4S,6S,8R)-6-[tert-butyl(dimethyl)silyl]oxy-8-tri(propan-2-yl)silyloxydec-1-en-9-yn-4-ol.
| Compound Name | (4S,6S,8R)-6-[tert-butyl(dimethyl)silyl]oxy-8-tri(propan-2-yl)silyloxydec-1-en-9-yn-4-ol |
|---|---|
| PubChem CID | 11190268 |
| Molecular Formula | C25H50O3Si2 |
| Molecular Weight | 454.84 g/mol |
| Exact Mass | 454.33 |
| IUPAC Name | (4S,6S,8R)-6-[tert-butyl(dimethyl)silyl]oxy-8-tri(propan-2-yl)silyloxydec-1-en-9-yn-4-ol |
| SMILES | C#C[C@@H](C[C@H](C[C@@H](O)CC=C)O[Si](C)(C)C(C)(C)C)O[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C25H50O3Si2/c1-14-16-22(26)17-24(27-29(12,13)25(9,10)11)18-23(15-2)28-30(19(3)4,20(5)6)21(7)8/h2,14,19-24,26H,1,16-18H2,3-13H3/t22-,23-,24-/m0/s1 |
| InChIKey | AEGGNNDOILVLAB-HJOGWXRNSA-N |
| XLogP | 7.29 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.84 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|