About 3-[4-[[3-(2,6-dimethyl-4-phenylmethoxyphenyl)phenyl]methoxy]phenyl]propanoic acid
3-[4-[[3-(2,6-dimethyl-4-phenylmethoxyphenyl)phenyl]methoxy]phenyl]propanoic acid (PubChem CID 11190525) has the molecular formula C31H30O4
and a molecular weight of 466.58 g/mol. Its IUPAC name is 3-[4-[[3-(2,6-dimethyl-4-phenylmethoxyphenyl)phenyl]methoxy]phenyl]propanoic acid.
Molecular Properties
| Compound Name | 3-[4-[[3-(2,6-dimethyl-4-phenylmethoxyphenyl)phenyl]methoxy]phenyl]propanoic acid |
| PubChem CID | 11190525 |
| Molecular Formula | C31H30O4 |
| Molecular Weight | 466.58 g/mol |
| Exact Mass | 466.21 |
| IUPAC Name | 3-[4-[[3-(2,6-dimethyl-4-phenylmethoxyphenyl)phenyl]methoxy]phenyl]propanoic acid |
| SMILES | Cc1cc(OCc2ccccc2)cc(C)c1-c1cccc(COc2ccc(CCC(=O)O)cc2)c1 |
| InChI | InChI=1S/C31H30O4/c1-22-17-29(35-20-25-7-4-3-5-8-25)18-23(2)31(22)27-10-6-9-26(19-27)21-34-28-14-11-24(12-15-28)13-16-30(32)33/h3-12,14-15,17-19H,13,16,20-21H2,1-2H3,(H,32,33) |
| InChIKey | LQOMYZIIIPFSQJ-UHFFFAOYSA-N |
| XLogP | 7.15 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 466.58 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[4-[[3-(2,6-dimethyl-4-phenylmethoxyphenyl)phenyl]methoxy]phenyl]propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[4-[[3-(2,6-dimethyl-4-phenylmethoxyphenyl)phenyl]methoxy]phenyl]propanoic acid?
The IUPAC name of 3-[4-[[3-(2,6-dimethyl-4-phenylmethoxyphenyl)phenyl]methoxy]phenyl]propanoic acid (CID 11190525) is 3-[4-[[3-(2,6-dimethyl-4-phenylmethoxyphenyl)phenyl]methoxy]phenyl]propanoic acid.
What is the SMILES notation for 3-[4-[[3-(2,6-dimethyl-4-phenylmethoxyphenyl)phenyl]methoxy]phenyl]propanoic acid?
The canonical SMILES for 3-[4-[[3-(2,6-dimethyl-4-phenylmethoxyphenyl)phenyl]methoxy]phenyl]propanoic acid is Cc1cc(OCc2ccccc2)cc(C)c1-c1cccc(COc2ccc(CCC(=O)O)cc2)c1.
What is the InChIKey of 3-[4-[[3-(2,6-dimethyl-4-phenylmethoxyphenyl)phenyl]methoxy]phenyl]propanoic acid?
The InChIKey is LQOMYZIIIPFSQJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C31H30O4/c1-22-17-29(35-20-25-7-4-3-5-8-25)18-23(2)31(22)27-10-6-9-26(19-27)21-34-28-14-11-24(12-15-28)13-16-30(32)33/h3-12,14-15,17-19H,13,16,20-21H2,1-2H3,(H,32,33).
What are the key properties of 3-[4-[[3-(2,6-dimethyl-4-phenylmethoxyphenyl)phenyl]methoxy]phenyl]propanoic acid?
3-[4-[[3-(2,6-dimethyl-4-phenylmethoxyphenyl)phenyl]methoxy]phenyl]propanoic acid has a molecular weight of 466.58 g/mol, XLogP of 7.15, 10 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[4-[[3-(2,6-dimethyl-4-phenylmethoxyphenyl)phenyl]methoxy]phenyl]propanoic acid is sourced from PubChem (CID 11190525), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).