C24H32N6O2 — CID 111905581
1-ethyl-2-[[2-(4-propoxyphenoxy)-3-pyridinyl]methyl]-3-(3-pyrazol-1-ylpropyl)guanidine (PubChem CID 111905581) has the molecular formula C24H32N6O2 and a molecular weight of 436.56 g/mol. Its IUPAC name is 1-ethyl-2-[[2-(4-propoxyphenoxy)-3-pyridinyl]methyl]-3-(3-pyrazol-1-ylpropyl)guanidine.
| Compound Name | 1-ethyl-2-[[2-(4-propoxyphenoxy)-3-pyridinyl]methyl]-3-(3-pyrazol-1-ylpropyl)guanidine |
|---|---|
| PubChem CID | 111905581 |
| Molecular Formula | C24H32N6O2 |
| Molecular Weight | 436.56 g/mol |
| Exact Mass | 436.26 |
| IUPAC Name | 1-ethyl-2-[[2-(4-propoxyphenoxy)-3-pyridinyl]methyl]-3-(3-pyrazol-1-ylpropyl)guanidine |
| SMILES | CCCOc1ccc(Oc2ncccc2C/N=C(\NCC)NCCCn2cccn2)cc1 |
| InChI | InChI=1S/C24H32N6O2/c1-3-18-31-21-9-11-22(12-10-21)32-23-20(8-5-13-26-23)19-28-24(25-4-2)27-14-6-16-30-17-7-15-29-30/h5,7-13,15,17H,3-4,6,14,16,18-19H2,1-2H3,(H2,25,27,28) |
| InChIKey | CHMFUXYNZFVUKW-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 85.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.56 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|