About N,N-diethyl-4-(6'-methylsulfonylspiro[azepane-4,2'-chromene]-4'-yl)benzamide
N,N-diethyl-4-(6'-methylsulfonylspiro[azepane-4,2'-chromene]-4'-yl)benzamide (PubChem CID 11190573) has the molecular formula C26H32N2O4S
and a molecular weight of 468.62 g/mol. Its IUPAC name is N,N-diethyl-4-(6'-methylsulfonylspiro[azepane-4,2'-chromene]-4'-yl)benzamide.
Molecular Properties
| Compound Name | N,N-diethyl-4-(6'-methylsulfonylspiro[azepane-4,2'-chromene]-4'-yl)benzamide |
| PubChem CID | 11190573 |
| Molecular Formula | C26H32N2O4S |
| Molecular Weight | 468.62 g/mol |
| Exact Mass | 468.21 |
| IUPAC Name | N,N-diethyl-4-(6'-methylsulfonylspiro[azepane-4,2'-chromene]-4'-yl)benzamide |
| SMILES | CCN(CC)C(=O)c1ccc(C2=CC3(CCCNCC3)Oc3ccc(S(C)(=O)=O)cc32)cc1 |
| InChI | InChI=1S/C26H32N2O4S/c1-4-28(5-2)25(29)20-9-7-19(8-10-20)23-18-26(13-6-15-27-16-14-26)32-24-12-11-21(17-22(23)24)33(3,30)31/h7-12,17-18,27H,4-6,13-16H2,1-3H3 |
| InChIKey | SMOYAFYYVIXGGR-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 468.62 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N,N-diethyl-4-(6'-methylsulfonylspiro[azepane-4,2'-chromene]-4'-yl)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-diethyl-4-(6'-methylsulfonylspiro[azepane-4,2'-chromene]-4'-yl)benzamide?
The IUPAC name of N,N-diethyl-4-(6'-methylsulfonylspiro[azepane-4,2'-chromene]-4'-yl)benzamide (CID 11190573) is N,N-diethyl-4-(6'-methylsulfonylspiro[azepane-4,2'-chromene]-4'-yl)benzamide.
What is the SMILES notation for N,N-diethyl-4-(6'-methylsulfonylspiro[azepane-4,2'-chromene]-4'-yl)benzamide?
The canonical SMILES for N,N-diethyl-4-(6'-methylsulfonylspiro[azepane-4,2'-chromene]-4'-yl)benzamide is CCN(CC)C(=O)c1ccc(C2=CC3(CCCNCC3)Oc3ccc(S(C)(=O)=O)cc32)cc1.
What is the InChIKey of N,N-diethyl-4-(6'-methylsulfonylspiro[azepane-4,2'-chromene]-4'-yl)benzamide?
The InChIKey is SMOYAFYYVIXGGR-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H32N2O4S/c1-4-28(5-2)25(29)20-9-7-19(8-10-20)23-18-26(13-6-15-27-16-14-26)32-24-12-11-21(17-22(23)24)33(3,30)31/h7-12,17-18,27H,4-6,13-16H2,1-3H3.
What are the key properties of N,N-diethyl-4-(6'-methylsulfonylspiro[azepane-4,2'-chromene]-4'-yl)benzamide?
N,N-diethyl-4-(6'-methylsulfonylspiro[azepane-4,2'-chromene]-4'-yl)benzamide has a molecular weight of 468.62 g/mol, XLogP of 3.91, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-diethyl-4-(6'-methylsulfonylspiro[azepane-4,2'-chromene]-4'-yl)benzamide is sourced from PubChem (CID 11190573), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).