C21H35N5O3S2 — CID 11190598
1,1-dicyclohexyl-3-[5-(4-methylpiperazin-1-yl)sulfonyl-1,3-thiazol-2-yl]urea (PubChem CID 11190598) has the molecular formula C21H35N5O3S2 and a molecular weight of 469.68 g/mol. Its IUPAC name is 1,1-dicyclohexyl-3-[5-(4-methylpiperazin-1-yl)sulfonyl-1,3-thiazol-2-yl]urea.
| Compound Name | 1,1-dicyclohexyl-3-[5-(4-methylpiperazin-1-yl)sulfonyl-1,3-thiazol-2-yl]urea |
|---|---|
| PubChem CID | 11190598 |
| Molecular Formula | C21H35N5O3S2 |
| Molecular Weight | 469.68 g/mol |
| Exact Mass | 469.22 |
| IUPAC Name | 1,1-dicyclohexyl-3-[5-(4-methylpiperazin-1-yl)sulfonyl-1,3-thiazol-2-yl]urea |
| SMILES | CN1CCN(S(=O)(=O)c2cnc(NC(=O)N(C3CCCCC3)C3CCCCC3)s2)CC1 |
| InChI | InChI=1S/C21H35N5O3S2/c1-24-12-14-25(15-13-24)31(28,29)19-16-22-20(30-19)23-21(27)26(17-8-4-2-5-9-17)18-10-6-3-7-11-18/h16-18H,2-15H2,1H3,(H,22,23,27) |
| InChIKey | KDKDXNAQFQNPGU-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 85.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.68 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |