C15H30N4O3 — CID 111906865
2-[[(1-methoxypropan-2-ylamino)-(oxan-2-ylmethylamino)methylidene]amino]-N,N-dimethylacetamide (PubChem CID 111906865) has the molecular formula C15H30N4O3 and a molecular weight of 314.43 g/mol. Its IUPAC name is 2-[[(1-methoxypropan-2-ylamino)-(oxan-2-ylmethylamino)methylidene]amino]-N,N-dimethylacetamide.
| Compound Name | 2-[[(1-methoxypropan-2-ylamino)-(oxan-2-ylmethylamino)methylidene]amino]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 111906865 |
| Molecular Formula | C15H30N4O3 |
| Molecular Weight | 314.43 g/mol |
| Exact Mass | 314.23 |
| IUPAC Name | 2-[[(1-methoxypropan-2-ylamino)-(oxan-2-ylmethylamino)methylidene]amino]-N,N-dimethylacetamide |
| SMILES | COCC(C)N/C(=N\CC(=O)N(C)C)NCC1CCCCO1 |
| InChI | InChI=1S/C15H30N4O3/c1-12(11-21-4)18-15(17-10-14(20)19(2)3)16-9-13-7-5-6-8-22-13/h12-13H,5-11H2,1-4H3,(H2,16,17,18) |
| InChIKey | BPYZRCNUHUATFC-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.43 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|