C18H38IN5O2 — CID 111906924
2-[[[2-[di(propan-2-yl)amino]ethylamino]-(oxolan-3-ylmethylamino)methylidene]amino]-N,N-dimethylacetamide;hydroiodide (PubChem CID 111906924) has the molecular formula C18H38IN5O2 and a molecular weight of 483.44 g/mol. Its IUPAC name is 2-[[[2-[di(propan-2-yl)amino]ethylamino]-(oxolan-3-ylmethylamino)methylidene]amino]-N,N-dimethylacetamide;hydroiodide.
| Compound Name | 2-[[[2-[di(propan-2-yl)amino]ethylamino]-(oxolan-3-ylmethylamino)methylidene]amino]-N,N-dimethylacetamide;hydroiodide |
|---|---|
| PubChem CID | 111906924 |
| Molecular Formula | C18H38IN5O2 |
| Molecular Weight | 483.44 g/mol |
| Exact Mass | 483.21 |
| IUPAC Name | 2-[[[2-[di(propan-2-yl)amino]ethylamino]-(oxolan-3-ylmethylamino)methylidene]amino]-N,N-dimethylacetamide;hydroiodide |
| SMILES | CC(C)N(CCN/C(=N\CC(=O)N(C)C)NCC1CCOC1)C(C)C.I |
| InChI | InChI=1S/C18H37N5O2.HI/c1-14(2)23(15(3)4)9-8-19-18(21-12-17(24)22(5)6)20-11-16-7-10-25-13-16;/h14-16H,7-13H2,1-6H3,(H2,19,20,21);1H |
| InChIKey | JZLVBDDBMXWHKS-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 69.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.44 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|