C21H34IN5O2 — CID 111907628
2-[[N'-[2-(tert-butylamino)-2-oxoethyl]-N-(1,2,3,4-tetrahydronaphthalen-2-yl)carbamimidoyl]amino]-N,N-dimethylacetamide;hydroiodide (PubChem CID 111907628) has the molecular formula C21H34IN5O2 and a molecular weight of 515.44 g/mol. Its IUPAC name is 2-[[N'-[2-(tert-butylamino)-2-oxoethyl]-N-(1,2,3,4-tetrahydronaphthalen-2-yl)carbamimidoyl]amino]-N,N-dimethylacetamide;hydroiodide.
| Compound Name | 2-[[N'-[2-(tert-butylamino)-2-oxoethyl]-N-(1,2,3,4-tetrahydronaphthalen-2-yl)carbamimidoyl]amino]-N,N-dimethylacetamide;hydroiodide |
|---|---|
| PubChem CID | 111907628 |
| Molecular Formula | C21H34IN5O2 |
| Molecular Weight | 515.44 g/mol |
| Exact Mass | 515.18 |
| IUPAC Name | 2-[[N'-[2-(tert-butylamino)-2-oxoethyl]-N-(1,2,3,4-tetrahydronaphthalen-2-yl)carbamimidoyl]amino]-N,N-dimethylacetamide;hydroiodide |
| SMILES | CN(C)C(=O)CN/C(=N\CC(=O)NC(C)(C)C)NC1CCc2ccccc2C1.I |
| InChI | InChI=1S/C21H33N5O2.HI/c1-21(2,3)25-18(27)13-22-20(23-14-19(28)26(4)5)24-17-11-10-15-8-6-7-9-16(15)12-17;/h6-9,17H,10-14H2,1-5H3,(H,25,27)(H2,22,23,24);1H |
| InChIKey | FCXDOVCGSTWXCB-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.44 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|