About ethyl 5-amino-3-dimorpholin-4-ylphosphoryl-1,2-oxazole-4-carboxylate
ethyl 5-amino-3-dimorpholin-4-ylphosphoryl-1,2-oxazole-4-carboxylate (PubChem CID 1119086) has the molecular formula C14H23N4O6P
and a molecular weight of 374.33 g/mol. Its IUPAC name is ethyl 5-amino-3-dimorpholin-4-ylphosphoryl-1,2-oxazole-4-carboxylate.
Molecular Properties
| Compound Name | ethyl 5-amino-3-dimorpholin-4-ylphosphoryl-1,2-oxazole-4-carboxylate |
| PubChem CID | 1119086 |
| Molecular Formula | C14H23N4O6P |
| Molecular Weight | 374.33 g/mol |
| Exact Mass | 374.14 |
| IUPAC Name | ethyl 5-amino-3-dimorpholin-4-ylphosphoryl-1,2-oxazole-4-carboxylate |
| SMILES | CCOC(=O)c1c(P(=O)(N2CCOCC2)N2CCOCC2)noc1N |
| InChI | InChI=1S/C14H23N4O6P/c1-2-23-14(19)11-12(15)24-16-13(11)25(20,17-3-7-21-8-4-17)18-5-9-22-10-6-18/h2-10,15H2,1H3 |
| InChIKey | KKWJPHQYEVDYTO-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 120.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 374.33 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze ethyl 5-amino-3-dimorpholin-4-ylphosphoryl-1,2-oxazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 5-amino-3-dimorpholin-4-ylphosphoryl-1,2-oxazole-4-carboxylate?
The IUPAC name of ethyl 5-amino-3-dimorpholin-4-ylphosphoryl-1,2-oxazole-4-carboxylate (CID 1119086) is ethyl 5-amino-3-dimorpholin-4-ylphosphoryl-1,2-oxazole-4-carboxylate.
What is the SMILES notation for ethyl 5-amino-3-dimorpholin-4-ylphosphoryl-1,2-oxazole-4-carboxylate?
The canonical SMILES for ethyl 5-amino-3-dimorpholin-4-ylphosphoryl-1,2-oxazole-4-carboxylate is CCOC(=O)c1c(P(=O)(N2CCOCC2)N2CCOCC2)noc1N.
What is the InChIKey of ethyl 5-amino-3-dimorpholin-4-ylphosphoryl-1,2-oxazole-4-carboxylate?
The InChIKey is KKWJPHQYEVDYTO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H23N4O6P/c1-2-23-14(19)11-12(15)24-16-13(11)25(20,17-3-7-21-8-4-17)18-5-9-22-10-6-18/h2-10,15H2,1H3.
What are the key properties of ethyl 5-amino-3-dimorpholin-4-ylphosphoryl-1,2-oxazole-4-carboxylate?
ethyl 5-amino-3-dimorpholin-4-ylphosphoryl-1,2-oxazole-4-carboxylate has a molecular weight of 374.33 g/mol, XLogP of -0.08, 5 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 5-amino-3-dimorpholin-4-ylphosphoryl-1,2-oxazole-4-carboxylate is sourced from PubChem (CID 1119086), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).