C16H23IN4O4 — CID 111908702
5-[[[N-[3-(furan-2-ylmethoxy)propyl]-N'-methylcarbamimidoyl]amino]methyl]furan-2-carboxamide;hydroiodide (PubChem CID 111908702) has the molecular formula C16H23IN4O4 and a molecular weight of 462.29 g/mol. Its IUPAC name is 5-[[[N-[3-(furan-2-ylmethoxy)propyl]-N'-methylcarbamimidoyl]amino]methyl]furan-2-carboxamide;hydroiodide.
| Compound Name | 5-[[[N-[3-(furan-2-ylmethoxy)propyl]-N'-methylcarbamimidoyl]amino]methyl]furan-2-carboxamide;hydroiodide |
|---|---|
| PubChem CID | 111908702 |
| Molecular Formula | C16H23IN4O4 |
| Molecular Weight | 462.29 g/mol |
| Exact Mass | 462.08 |
| IUPAC Name | 5-[[[N-[3-(furan-2-ylmethoxy)propyl]-N'-methylcarbamimidoyl]amino]methyl]furan-2-carboxamide;hydroiodide |
| SMILES | C/N=C(\NCCCOCc1ccco1)NCc1ccc(C(N)=O)o1.I |
| InChI | InChI=1S/C16H22N4O4.HI/c1-18-16(20-10-12-5-6-14(24-12)15(17)21)19-7-3-8-22-11-13-4-2-9-23-13;/h2,4-6,9H,3,7-8,10-11H2,1H3,(H2,17,21)(H2,18,19,20);1H |
| InChIKey | APBFYNWCOVEJIO-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 115.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.29 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|