About ethyl 1-(2,4-dichlorophenyl)-2-(4-iodophenyl)imidazole-4-carboxylate
ethyl 1-(2,4-dichlorophenyl)-2-(4-iodophenyl)imidazole-4-carboxylate (PubChem CID 11190972) has the molecular formula C18H13Cl2IN2O2
and a molecular weight of 487.12 g/mol. Its IUPAC name is ethyl 1-(2,4-dichlorophenyl)-2-(4-iodophenyl)imidazole-4-carboxylate.
Molecular Properties
| Compound Name | ethyl 1-(2,4-dichlorophenyl)-2-(4-iodophenyl)imidazole-4-carboxylate |
| PubChem CID | 11190972 |
| Molecular Formula | C18H13Cl2IN2O2 |
| Molecular Weight | 487.12 g/mol |
| Exact Mass | 485.94 |
| IUPAC Name | ethyl 1-(2,4-dichlorophenyl)-2-(4-iodophenyl)imidazole-4-carboxylate |
| SMILES | CCOC(=O)c1cn(-c2ccc(Cl)cc2Cl)c(-c2ccc(I)cc2)n1 |
| InChI | InChI=1S/C18H13Cl2IN2O2/c1-2-25-18(24)15-10-23(16-8-5-12(19)9-14(16)20)17(22-15)11-3-6-13(21)7-4-11/h3-10H,2H2,1H3 |
| InChIKey | XMPGJQRGABEVNV-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 487.12 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze ethyl 1-(2,4-dichlorophenyl)-2-(4-iodophenyl)imidazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 1-(2,4-dichlorophenyl)-2-(4-iodophenyl)imidazole-4-carboxylate?
The IUPAC name of ethyl 1-(2,4-dichlorophenyl)-2-(4-iodophenyl)imidazole-4-carboxylate (CID 11190972) is ethyl 1-(2,4-dichlorophenyl)-2-(4-iodophenyl)imidazole-4-carboxylate.
What is the SMILES notation for ethyl 1-(2,4-dichlorophenyl)-2-(4-iodophenyl)imidazole-4-carboxylate?
The canonical SMILES for ethyl 1-(2,4-dichlorophenyl)-2-(4-iodophenyl)imidazole-4-carboxylate is CCOC(=O)c1cn(-c2ccc(Cl)cc2Cl)c(-c2ccc(I)cc2)n1.
What is the InChIKey of ethyl 1-(2,4-dichlorophenyl)-2-(4-iodophenyl)imidazole-4-carboxylate?
The InChIKey is XMPGJQRGABEVNV-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H13Cl2IN2O2/c1-2-25-18(24)15-10-23(16-8-5-12(19)9-14(16)20)17(22-15)11-3-6-13(21)7-4-11/h3-10H,2H2,1H3.
What are the key properties of ethyl 1-(2,4-dichlorophenyl)-2-(4-iodophenyl)imidazole-4-carboxylate?
ethyl 1-(2,4-dichlorophenyl)-2-(4-iodophenyl)imidazole-4-carboxylate has a molecular weight of 487.12 g/mol, XLogP of 5.63, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 1-(2,4-dichlorophenyl)-2-(4-iodophenyl)imidazole-4-carboxylate is sourced from PubChem (CID 11190972), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).