C19H26N4S — CID 111910347
1-ethyl-2-[(3-methylthiophen-2-yl)methyl]-3-(1-phenylpyrrolidin-3-yl)guanidine (PubChem CID 111910347) has the molecular formula C19H26N4S and a molecular weight of 342.51 g/mol. Its IUPAC name is 1-ethyl-2-[(3-methylthiophen-2-yl)methyl]-3-(1-phenylpyrrolidin-3-yl)guanidine.
| Compound Name | 1-ethyl-2-[(3-methylthiophen-2-yl)methyl]-3-(1-phenylpyrrolidin-3-yl)guanidine |
|---|---|
| PubChem CID | 111910347 |
| Molecular Formula | C19H26N4S |
| Molecular Weight | 342.51 g/mol |
| Exact Mass | 342.19 |
| IUPAC Name | 1-ethyl-2-[(3-methylthiophen-2-yl)methyl]-3-(1-phenylpyrrolidin-3-yl)guanidine |
| SMILES | CCN/C(=N\Cc1sccc1C)NC1CCN(c2ccccc2)C1 |
| InChI | InChI=1S/C19H26N4S/c1-3-20-19(21-13-18-15(2)10-12-24-18)22-16-9-11-23(14-16)17-7-5-4-6-8-17/h4-8,10,12,16H,3,9,11,13-14H2,1-2H3,(H2,20,21,22) |
| InChIKey | IDXJIWUUBHLJMV-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.51 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|