C30H34O6 — CID 11191042
ethyl 9b-(3a-ethoxycarbonyl-2,3,4,5-tetrahydrobenzo[g][1]benzofuran-9b-yl)-2,3,4,5-tetrahydrobenzo[g][1]benzofuran-3a-carboxylate (PubChem CID 11191042) has the molecular formula C30H34O6 and a molecular weight of 490.60 g/mol. Its IUPAC name is ethyl 9b-(3a-ethoxycarbonyl-2,3,4,5-tetrahydrobenzo[g][1]benzofuran-9b-yl)-2,3,4,5-tetrahydrobenzo[g][1]benzofuran-3a-carboxylate.
| Compound Name | ethyl 9b-(3a-ethoxycarbonyl-2,3,4,5-tetrahydrobenzo[g][1]benzofuran-9b-yl)-2,3,4,5-tetrahydrobenzo[g][1]benzofuran-3a-carboxylate |
|---|---|
| PubChem CID | 11191042 |
| Molecular Formula | C30H34O6 |
| Molecular Weight | 490.60 g/mol |
| Exact Mass | 490.24 |
| IUPAC Name | ethyl 9b-(3a-ethoxycarbonyl-2,3,4,5-tetrahydrobenzo[g][1]benzofuran-9b-yl)-2,3,4,5-tetrahydrobenzo[g][1]benzofuran-3a-carboxylate |
| SMILES | CCOC(=O)C12CCOC1(C13OCCC1(C(=O)OCC)CCc1ccccc13)c1ccccc1CC2 |
| InChI | InChI=1S/C30H34O6/c1-3-33-25(31)27-15-13-21-9-5-7-11-23(21)29(27,35-19-17-27)30-24-12-8-6-10-22(24)14-16-28(30,18-20-36-30)26(32)34-4-2/h5-12H,3-4,13-20H2,1-2H3 |
| InChIKey | PVSXADFNQITQEB-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.60 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |