C10H9Br4N3 — CID 11191050
4,5,6,7-tetrabromo-N-propan-2-yl-1H-benzimidazol-2-amine (PubChem CID 11191050) has the molecular formula C10H9Br4N3 and a molecular weight of 490.82 g/mol. Its IUPAC name is 4,5,6,7-tetrabromo-N-propan-2-yl-1H-benzimidazol-2-amine.
| Compound Name | 4,5,6,7-tetrabromo-N-propan-2-yl-1H-benzimidazol-2-amine |
|---|---|
| PubChem CID | 11191050 |
| Molecular Formula | C10H9Br4N3 |
| Molecular Weight | 490.82 g/mol |
| Exact Mass | 486.75 |
| IUPAC Name | 4,5,6,7-tetrabromo-N-propan-2-yl-1H-benzimidazol-2-amine |
| SMILES | CC(C)Nc1nc2c(Br)c(Br)c(Br)c(Br)c2[nH]1 |
| InChI | InChI=1S/C10H9Br4N3/c1-3(2)15-10-16-8-6(13)4(11)5(12)7(14)9(8)17-10/h3H,1-2H3,(H2,15,16,17) |
| InChIKey | CDJQUXBTHFJZGZ-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.82 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|