C22H31IN6O — CID 111910670
3-[[ethylamino-[(1-phenylpyrrolidin-3-yl)amino]methylidene]amino]-N-(5-methyl-2-pyridinyl)propanamide;hydroiodide (PubChem CID 111910670) has the molecular formula C22H31IN6O and a molecular weight of 522.44 g/mol. Its IUPAC name is 3-[[ethylamino-[(1-phenylpyrrolidin-3-yl)amino]methylidene]amino]-N-(5-methyl-2-pyridinyl)propanamide;hydroiodide.
| Compound Name | 3-[[ethylamino-[(1-phenylpyrrolidin-3-yl)amino]methylidene]amino]-N-(5-methyl-2-pyridinyl)propanamide;hydroiodide |
|---|---|
| PubChem CID | 111910670 |
| Molecular Formula | C22H31IN6O |
| Molecular Weight | 522.44 g/mol |
| Exact Mass | 522.16 |
| IUPAC Name | 3-[[ethylamino-[(1-phenylpyrrolidin-3-yl)amino]methylidene]amino]-N-(5-methyl-2-pyridinyl)propanamide;hydroiodide |
| SMILES | CCN/C(=N\CCC(=O)Nc1ccc(C)cn1)NC1CCN(c2ccccc2)C1.I |
| InChI | InChI=1S/C22H30N6O.HI/c1-3-23-22(24-13-11-21(29)27-20-10-9-17(2)15-25-20)26-18-12-14-28(16-18)19-7-5-4-6-8-19;/h4-10,15,18H,3,11-14,16H2,1-2H3,(H2,23,24,26)(H,25,27,29);1H |
| InChIKey | KHGGETGPWISMBE-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 81.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.44 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|