C29H23BF2N2O3 — CID 11191160
4-[2,2-difluoro-4,12-bis(4-methoxyphenyl)-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaen-8-yl]phenol (PubChem CID 11191160) has the molecular formula C29H23BF2N2O3 and a molecular weight of 496.32 g/mol. Its IUPAC name is 4-[2,2-difluoro-4,12-bis(4-methoxyphenyl)-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaen-8-yl]phenol.
| Compound Name | 4-[2,2-difluoro-4,12-bis(4-methoxyphenyl)-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaen-8-yl]phenol |
|---|---|
| PubChem CID | 11191160 |
| Molecular Formula | C29H23BF2N2O3 |
| Molecular Weight | 496.32 g/mol |
| Exact Mass | 496.18 |
| IUPAC Name | 4-[2,2-difluoro-4,12-bis(4-methoxyphenyl)-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaen-8-yl]phenol |
| SMILES | COc1ccc(C2=[N+]3C(=C(c4ccc(O)cc4)c4ccc(-c5ccc(OC)cc5)n4[B-]3(F)F)C=C2)cc1 |
| InChI | InChI=1S/C29H23BF2N2O3/c1-36-23-11-5-19(6-12-23)25-15-17-27-29(21-3-9-22(35)10-4-21)28-18-16-26(34(28)30(31,32)33(25)27)20-7-13-24(37-2)14-8-20/h3-18,35H,1-2H3 |
| InChIKey | AHWCRMPGHBPTRU-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 46.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.32 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|