About 4-acetyl-N-[2-(2,6-difluorophenyl)-2-hydroxyethyl]-1-methylpyrrole-2-carboxamide
4-acetyl-N-[2-(2,6-difluorophenyl)-2-hydroxyethyl]-1-methylpyrrole-2-carboxamide (PubChem CID 111912024) has the molecular formula C16H16F2N2O3
and a molecular weight of 322.31 g/mol. Its IUPAC name is 4-acetyl-N-[2-(2,6-difluorophenyl)-2-hydroxyethyl]-1-methylpyrrole-2-carboxamide.
Molecular Properties
| Compound Name | 4-acetyl-N-[2-(2,6-difluorophenyl)-2-hydroxyethyl]-1-methylpyrrole-2-carboxamide |
| PubChem CID | 111912024 |
| Molecular Formula | C16H16F2N2O3 |
| Molecular Weight | 322.31 g/mol |
| Exact Mass | 322.11 |
| IUPAC Name | 4-acetyl-N-[2-(2,6-difluorophenyl)-2-hydroxyethyl]-1-methylpyrrole-2-carboxamide |
| SMILES | CC(=O)c1cc(C(=O)NCC(O)c2c(F)cccc2F)n(C)c1 |
| InChI | InChI=1S/C16H16F2N2O3/c1-9(21)10-6-13(20(2)8-10)16(23)19-7-14(22)15-11(17)4-3-5-12(15)18/h3-6,8,14,22H,7H2,1-2H3,(H,19,23) |
| InChIKey | ZRVUSVBEHHFKJG-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 71.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.31 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-acetyl-N-[2-(2,6-difluorophenyl)-2-hydroxyethyl]-1-methylpyrrole-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-acetyl-N-[2-(2,6-difluorophenyl)-2-hydroxyethyl]-1-methylpyrrole-2-carboxamide?
The IUPAC name of 4-acetyl-N-[2-(2,6-difluorophenyl)-2-hydroxyethyl]-1-methylpyrrole-2-carboxamide (CID 111912024) is 4-acetyl-N-[2-(2,6-difluorophenyl)-2-hydroxyethyl]-1-methylpyrrole-2-carboxamide.
What is the SMILES notation for 4-acetyl-N-[2-(2,6-difluorophenyl)-2-hydroxyethyl]-1-methylpyrrole-2-carboxamide?
The canonical SMILES for 4-acetyl-N-[2-(2,6-difluorophenyl)-2-hydroxyethyl]-1-methylpyrrole-2-carboxamide is CC(=O)c1cc(C(=O)NCC(O)c2c(F)cccc2F)n(C)c1.
What is the InChIKey of 4-acetyl-N-[2-(2,6-difluorophenyl)-2-hydroxyethyl]-1-methylpyrrole-2-carboxamide?
The InChIKey is ZRVUSVBEHHFKJG-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16F2N2O3/c1-9(21)10-6-13(20(2)8-10)16(23)19-7-14(22)15-11(17)4-3-5-12(15)18/h3-6,8,14,22H,7H2,1-2H3,(H,19,23).
What are the key properties of 4-acetyl-N-[2-(2,6-difluorophenyl)-2-hydroxyethyl]-1-methylpyrrole-2-carboxamide?
4-acetyl-N-[2-(2,6-difluorophenyl)-2-hydroxyethyl]-1-methylpyrrole-2-carboxamide has a molecular weight of 322.31 g/mol, XLogP of 1.97, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-acetyl-N-[2-(2,6-difluorophenyl)-2-hydroxyethyl]-1-methylpyrrole-2-carboxamide is sourced from PubChem (CID 111912024), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).