C25H18Cl3N3O2 — CID 11191223
9-(4-chlorophenyl)-8-(2,4-dichlorophenyl)-2,4,6-trimethyl-4H-[1,3]oxazino[5,4-c][1,8]naphthyridin-5-one (PubChem CID 11191223) has the molecular formula C25H18Cl3N3O2 and a molecular weight of 498.80 g/mol. Its IUPAC name is 9-(4-chlorophenyl)-8-(2,4-dichlorophenyl)-2,4,6-trimethyl-4H-[1,3]oxazino[5,4-c][1,8]naphthyridin-5-one.
| Compound Name | 9-(4-chlorophenyl)-8-(2,4-dichlorophenyl)-2,4,6-trimethyl-4H-[1,3]oxazino[5,4-c][1,8]naphthyridin-5-one |
|---|---|
| PubChem CID | 11191223 |
| Molecular Formula | C25H18Cl3N3O2 |
| Molecular Weight | 498.80 g/mol |
| Exact Mass | 497.05 |
| IUPAC Name | 9-(4-chlorophenyl)-8-(2,4-dichlorophenyl)-2,4,6-trimethyl-4H-[1,3]oxazino[5,4-c][1,8]naphthyridin-5-one |
| SMILES | CC1=Nc2c(c(=O)n(C)c3nc(-c4ccc(Cl)cc4Cl)c(-c4ccc(Cl)cc4)cc23)C(C)O1 |
| InChI | InChI=1S/C25H18Cl3N3O2/c1-12-21-23(29-13(2)33-12)19-11-18(14-4-6-15(26)7-5-14)22(30-24(19)31(3)25(21)32)17-9-8-16(27)10-20(17)28/h4-12H,1-3H3 |
| InChIKey | SDGLFXVDRAAZLX-UHFFFAOYSA-N |
| XLogP | 7.37 |
| TPSA | 56.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.80 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |