About [1-[(5-nitro-1,3-benzoxazol-2-yl)methyl]piperidin-3-yl]methanol
[1-[(5-nitro-1,3-benzoxazol-2-yl)methyl]piperidin-3-yl]methanol (PubChem CID 111912633) has the molecular formula C14H17N3O4
and a molecular weight of 291.31 g/mol. Its IUPAC name is [1-[(5-nitro-1,3-benzoxazol-2-yl)methyl]piperidin-3-yl]methanol.
Molecular Properties
| Compound Name | [1-[(5-nitro-1,3-benzoxazol-2-yl)methyl]piperidin-3-yl]methanol |
| PubChem CID | 111912633 |
| Molecular Formula | C14H17N3O4 |
| Molecular Weight | 291.31 g/mol |
| Exact Mass | 291.12 |
| IUPAC Name | [1-[(5-nitro-1,3-benzoxazol-2-yl)methyl]piperidin-3-yl]methanol |
| SMILES | O=[N+]([O-])c1ccc2oc(CN3CCCC(CO)C3)nc2c1 |
| InChI | InChI=1S/C14H17N3O4/c18-9-10-2-1-5-16(7-10)8-14-15-12-6-11(17(19)20)3-4-13(12)21-14/h3-4,6,10,18H,1-2,5,7-9H2 |
| InChIKey | HBCRICVIRZZBGE-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 92.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.31 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [1-[(5-nitro-1,3-benzoxazol-2-yl)methyl]piperidin-3-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-[(5-nitro-1,3-benzoxazol-2-yl)methyl]piperidin-3-yl]methanol?
The IUPAC name of [1-[(5-nitro-1,3-benzoxazol-2-yl)methyl]piperidin-3-yl]methanol (CID 111912633) is [1-[(5-nitro-1,3-benzoxazol-2-yl)methyl]piperidin-3-yl]methanol.
What is the SMILES notation for [1-[(5-nitro-1,3-benzoxazol-2-yl)methyl]piperidin-3-yl]methanol?
The canonical SMILES for [1-[(5-nitro-1,3-benzoxazol-2-yl)methyl]piperidin-3-yl]methanol is O=[N+]([O-])c1ccc2oc(CN3CCCC(CO)C3)nc2c1.
What is the InChIKey of [1-[(5-nitro-1,3-benzoxazol-2-yl)methyl]piperidin-3-yl]methanol?
The InChIKey is HBCRICVIRZZBGE-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17N3O4/c18-9-10-2-1-5-16(7-10)8-14-15-12-6-11(17(19)20)3-4-13(12)21-14/h3-4,6,10,18H,1-2,5,7-9H2.
What are the key properties of [1-[(5-nitro-1,3-benzoxazol-2-yl)methyl]piperidin-3-yl]methanol?
[1-[(5-nitro-1,3-benzoxazol-2-yl)methyl]piperidin-3-yl]methanol has a molecular weight of 291.31 g/mol, XLogP of 1.94, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [1-[(5-nitro-1,3-benzoxazol-2-yl)methyl]piperidin-3-yl]methanol is sourced from PubChem (CID 111912633), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).