C23H32IN5O3 — CID 111912989
2-methyl-1-[2-(5-methylfuran-2-yl)-2-morpholin-4-ylethyl]-3-(5-oxo-1-phenylpyrrolidin-3-yl)guanidine;hydroiodide (PubChem CID 111912989) has the molecular formula C23H32IN5O3 and a molecular weight of 553.45 g/mol. Its IUPAC name is 2-methyl-1-[2-(5-methylfuran-2-yl)-2-morpholin-4-ylethyl]-3-(5-oxo-1-phenylpyrrolidin-3-yl)guanidine;hydroiodide.
| Compound Name | 2-methyl-1-[2-(5-methylfuran-2-yl)-2-morpholin-4-ylethyl]-3-(5-oxo-1-phenylpyrrolidin-3-yl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111912989 |
| Molecular Formula | C23H32IN5O3 |
| Molecular Weight | 553.45 g/mol |
| Exact Mass | 553.15 |
| IUPAC Name | 2-methyl-1-[2-(5-methylfuran-2-yl)-2-morpholin-4-ylethyl]-3-(5-oxo-1-phenylpyrrolidin-3-yl)guanidine;hydroiodide |
| SMILES | C/N=C(\NCC(c1ccc(C)o1)N1CCOCC1)NC1CC(=O)N(c2ccccc2)C1.I |
| InChI | InChI=1S/C23H31N5O3.HI/c1-17-8-9-21(31-17)20(27-10-12-30-13-11-27)15-25-23(24-2)26-18-14-22(29)28(16-18)19-6-4-3-5-7-19;/h3-9,18,20H,10-16H2,1-2H3,(H2,24,25,26);1H |
| InChIKey | NIBQVSNWZCAHRK-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 82.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.45 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|