C28H38N4O5 — CID 11191451
(2R)-N-[1-[[(2S)-1-amino-4-methyl-1-oxopentan-2-yl]amino]-3-naphthalen-1-yl-1-oxopropan-2-yl]-2-(cyclobutylmethyl)-N'-hydroxybutanediamide (PubChem CID 11191451) has the molecular formula C28H38N4O5 and a molecular weight of 510.64 g/mol. Its IUPAC name is (2R)-N-[1-[[(2S)-1-amino-4-methyl-1-oxopentan-2-yl]amino]-3-naphthalen-1-yl-1-oxopropan-2-yl]-2-(cyclobutylmethyl)-N'-hydroxybutanediamide.
| Compound Name | (2R)-N-[1-[[(2S)-1-amino-4-methyl-1-oxopentan-2-yl]amino]-3-naphthalen-1-yl-1-oxopropan-2-yl]-2-(cyclobutylmethyl)-N'-hydroxybutanediamide |
|---|---|
| PubChem CID | 11191451 |
| Molecular Formula | C28H38N4O5 |
| Molecular Weight | 510.64 g/mol |
| Exact Mass | 510.28 |
| IUPAC Name | (2R)-N-[1-[[(2S)-1-amino-4-methyl-1-oxopentan-2-yl]amino]-3-naphthalen-1-yl-1-oxopropan-2-yl]-2-(cyclobutylmethyl)-N'-hydroxybutanediamide |
| SMILES | CC(C)C[C@H](NC(=O)C(Cc1cccc2ccccc12)NC(=O)[C@@H](CC(=O)NO)CC1CCC1)C(N)=O |
| InChI | InChI=1S/C28H38N4O5/c1-17(2)13-23(26(29)34)30-28(36)24(15-20-11-6-10-19-9-3-4-12-22(19)20)31-27(35)21(16-25(33)32-37)14-18-7-5-8-18/h3-4,6,9-12,17-18,21,23-24,37H,5,7-8,13-16H2,1-2H3,(H2,29,34)(H,30,36)(H,31,35)(H,32,33)/t21-,23+,24?/m1/s1 |
| InChIKey | GYWUJNREMKBXJL-RZVHPXSESA-N |
| XLogP | 2.59 |
| TPSA | 150.62 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.64 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|