C13H20F3N5S — CID 111915006
2-methyl-1-[(2-methyl-1,3-thiazol-5-yl)methyl]-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine (PubChem CID 111915006) has the molecular formula C13H20F3N5S and a molecular weight of 335.40 g/mol. Its IUPAC name is 2-methyl-1-[(2-methyl-1,3-thiazol-5-yl)methyl]-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine.
| Compound Name | 2-methyl-1-[(2-methyl-1,3-thiazol-5-yl)methyl]-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine |
|---|---|
| PubChem CID | 111915006 |
| Molecular Formula | C13H20F3N5S |
| Molecular Weight | 335.40 g/mol |
| Exact Mass | 335.14 |
| IUPAC Name | 2-methyl-1-[(2-methyl-1,3-thiazol-5-yl)methyl]-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine |
| SMILES | C/N=C(\NCc1cnc(C)s1)NC1CCN(CC(F)(F)F)C1 |
| InChI | InChI=1S/C13H20F3N5S/c1-9-18-5-11(22-9)6-19-12(17-2)20-10-3-4-21(7-10)8-13(14,15)16/h5,10H,3-4,6-8H2,1-2H3,(H2,17,19,20) |
| InChIKey | JXEDODWGJUZWKM-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 52.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.40 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|