C14H19F3N6S — CID 111915213
1-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)-2-methyl-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine (PubChem CID 111915213) has the molecular formula C14H19F3N6S and a molecular weight of 360.41 g/mol. Its IUPAC name is 1-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)-2-methyl-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine.
| Compound Name | 1-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)-2-methyl-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine |
|---|---|
| PubChem CID | 111915213 |
| Molecular Formula | C14H19F3N6S |
| Molecular Weight | 360.41 g/mol |
| Exact Mass | 360.13 |
| IUPAC Name | 1-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)-2-methyl-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine |
| SMILES | C/N=C(\NCc1cn2ccsc2n1)NC1CCN(CC(F)(F)F)C1 |
| InChI | InChI=1S/C14H19F3N6S/c1-18-12(19-6-11-8-23-4-5-24-13(23)21-11)20-10-2-3-22(7-10)9-14(15,16)17/h4-5,8,10H,2-3,6-7,9H2,1H3,(H2,18,19,20) |
| InChIKey | PSTKCFMFSYNBFB-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 56.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.41 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|