C13H23F3N4O2 — CID 111915377
methyl 3-[[ethylamino-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]amino]methylidene]amino]propanoate (PubChem CID 111915377) has the molecular formula C13H23F3N4O2 and a molecular weight of 324.35 g/mol. Its IUPAC name is methyl 3-[[ethylamino-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]amino]methylidene]amino]propanoate.
| Compound Name | methyl 3-[[ethylamino-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]amino]methylidene]amino]propanoate |
|---|---|
| PubChem CID | 111915377 |
| Molecular Formula | C13H23F3N4O2 |
| Molecular Weight | 324.35 g/mol |
| Exact Mass | 324.18 |
| IUPAC Name | methyl 3-[[ethylamino-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]amino]methylidene]amino]propanoate |
| SMILES | CCN/C(=N\CCC(=O)OC)NC1CCN(CC(F)(F)F)C1 |
| InChI | InChI=1S/C13H23F3N4O2/c1-3-17-12(18-6-4-11(21)22-2)19-10-5-7-20(8-10)9-13(14,15)16/h10H,3-9H2,1-2H3,(H2,17,18,19) |
| InChIKey | JHCWLMWKVGDJLZ-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.35 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|