C19H36F3N5O — CID 111916023
1-(3-ethyl-2-morpholin-4-ylpentyl)-2-methyl-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine (PubChem CID 111916023) has the molecular formula C19H36F3N5O and a molecular weight of 407.53 g/mol. Its IUPAC name is 1-(3-ethyl-2-morpholin-4-ylpentyl)-2-methyl-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine.
| Compound Name | 1-(3-ethyl-2-morpholin-4-ylpentyl)-2-methyl-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine |
|---|---|
| PubChem CID | 111916023 |
| Molecular Formula | C19H36F3N5O |
| Molecular Weight | 407.53 g/mol |
| Exact Mass | 407.29 |
| IUPAC Name | 1-(3-ethyl-2-morpholin-4-ylpentyl)-2-methyl-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine |
| SMILES | CCC(CC)C(CN/C(=N\C)NC1CCN(CC(F)(F)F)C1)N1CCOCC1 |
| InChI | InChI=1S/C19H36F3N5O/c1-4-15(5-2)17(27-8-10-28-11-9-27)12-24-18(23-3)25-16-6-7-26(13-16)14-19(20,21)22/h15-17H,4-14H2,1-3H3,(H2,23,24,25) |
| InChIKey | RFLZYHRBSNWZRB-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 52.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.53 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|