C18H35F3IN5O2 — CID 111916247
ethyl N-[1-[[ethylamino-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]amino]methylidene]amino]-4-methylpentan-2-yl]carbamate;hydroiodide (PubChem CID 111916247) has the molecular formula C18H35F3IN5O2 and a molecular weight of 537.41 g/mol. Its IUPAC name is ethyl N-[1-[[ethylamino-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]amino]methylidene]amino]-4-methylpentan-2-yl]carbamate;hydroiodide.
| Compound Name | ethyl N-[1-[[ethylamino-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]amino]methylidene]amino]-4-methylpentan-2-yl]carbamate;hydroiodide |
|---|---|
| PubChem CID | 111916247 |
| Molecular Formula | C18H35F3IN5O2 |
| Molecular Weight | 537.41 g/mol |
| Exact Mass | 537.18 |
| IUPAC Name | ethyl N-[1-[[ethylamino-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]amino]methylidene]amino]-4-methylpentan-2-yl]carbamate;hydroiodide |
| SMILES | CCN/C(=N\CC(CC(C)C)NC(=O)OCC)NC1CCN(CC(F)(F)F)C1.I |
| InChI | InChI=1S/C18H34F3N5O2.HI/c1-5-22-16(24-14-7-8-26(11-14)12-18(19,20)21)23-10-15(9-13(3)4)25-17(27)28-6-2;/h13-15H,5-12H2,1-4H3,(H,25,27)(H2,22,23,24);1H |
| InChIKey | WPTXFJNWHLKAPJ-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 77.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.41 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|