About 3-[[(1,3-dimethyl-5-pyridin-3-yloxypyrazol-4-yl)methylamino]methyl]pentan-3-ol
3-[[(1,3-dimethyl-5-pyridin-3-yloxypyrazol-4-yl)methylamino]methyl]pentan-3-ol (PubChem CID 111916604) has the molecular formula C17H26N4O2
and a molecular weight of 318.42 g/mol. Its IUPAC name is 3-[[(1,3-dimethyl-5-pyridin-3-yloxypyrazol-4-yl)methylamino]methyl]pentan-3-ol.
Molecular Properties
| Compound Name | 3-[[(1,3-dimethyl-5-pyridin-3-yloxypyrazol-4-yl)methylamino]methyl]pentan-3-ol |
| PubChem CID | 111916604 |
| Molecular Formula | C17H26N4O2 |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.21 |
| IUPAC Name | 3-[[(1,3-dimethyl-5-pyridin-3-yloxypyrazol-4-yl)methylamino]methyl]pentan-3-ol |
| SMILES | CCC(O)(CC)CNCc1c(C)nn(C)c1Oc1cccnc1 |
| InChI | InChI=1S/C17H26N4O2/c1-5-17(22,6-2)12-19-11-15-13(3)20-21(4)16(15)23-14-8-7-9-18-10-14/h7-10,19,22H,5-6,11-12H2,1-4H3 |
| InChIKey | QVFNMPDUCNTQIK-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 72.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-[[(1,3-dimethyl-5-pyridin-3-yloxypyrazol-4-yl)methylamino]methyl]pentan-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[(1,3-dimethyl-5-pyridin-3-yloxypyrazol-4-yl)methylamino]methyl]pentan-3-ol?
The IUPAC name of 3-[[(1,3-dimethyl-5-pyridin-3-yloxypyrazol-4-yl)methylamino]methyl]pentan-3-ol (CID 111916604) is 3-[[(1,3-dimethyl-5-pyridin-3-yloxypyrazol-4-yl)methylamino]methyl]pentan-3-ol.
What is the SMILES notation for 3-[[(1,3-dimethyl-5-pyridin-3-yloxypyrazol-4-yl)methylamino]methyl]pentan-3-ol?
The canonical SMILES for 3-[[(1,3-dimethyl-5-pyridin-3-yloxypyrazol-4-yl)methylamino]methyl]pentan-3-ol is CCC(O)(CC)CNCc1c(C)nn(C)c1Oc1cccnc1.
What is the InChIKey of 3-[[(1,3-dimethyl-5-pyridin-3-yloxypyrazol-4-yl)methylamino]methyl]pentan-3-ol?
The InChIKey is QVFNMPDUCNTQIK-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H26N4O2/c1-5-17(22,6-2)12-19-11-15-13(3)20-21(4)16(15)23-14-8-7-9-18-10-14/h7-10,19,22H,5-6,11-12H2,1-4H3.
What are the key properties of 3-[[(1,3-dimethyl-5-pyridin-3-yloxypyrazol-4-yl)methylamino]methyl]pentan-3-ol?
3-[[(1,3-dimethyl-5-pyridin-3-yloxypyrazol-4-yl)methylamino]methyl]pentan-3-ol has a molecular weight of 318.42 g/mol, XLogP of 2.56, 8 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[(1,3-dimethyl-5-pyridin-3-yloxypyrazol-4-yl)methylamino]methyl]pentan-3-ol is sourced from PubChem (CID 111916604), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).