C17H19ClN2O — CID 111916624
1-[[(6-chloro-3-pyridinyl)methylamino]methyl]-3,4-dihydro-2H-naphthalen-1-ol (PubChem CID 111916624) has the molecular formula C17H19ClN2O and a molecular weight of 302.81 g/mol. Its IUPAC name is 1-[[(6-chloro-3-pyridinyl)methylamino]methyl]-3,4-dihydro-2H-naphthalen-1-ol.
| Compound Name | 1-[[(6-chloro-3-pyridinyl)methylamino]methyl]-3,4-dihydro-2H-naphthalen-1-ol |
|---|---|
| PubChem CID | 111916624 |
| Molecular Formula | C17H19ClN2O |
| Molecular Weight | 302.81 g/mol |
| Exact Mass | 302.12 |
| IUPAC Name | 1-[[(6-chloro-3-pyridinyl)methylamino]methyl]-3,4-dihydro-2H-naphthalen-1-ol |
| SMILES | OC1(CNCc2ccc(Cl)nc2)CCCc2ccccc21 |
| InChI | InChI=1S/C17H19ClN2O/c18-16-8-7-13(11-20-16)10-19-12-17(21)9-3-5-14-4-1-2-6-15(14)17/h1-2,4,6-8,11,19,21H,3,5,9-10,12H2 |
| InChIKey | OYWLILMWLMLAGJ-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.81 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|