About (5Z)-5-[iodo(phenyl)methylidene]-2-methyl-2,3,4-triphenylfuran
(5Z)-5-[iodo(phenyl)methylidene]-2-methyl-2,3,4-triphenylfuran (PubChem CID 11191718) has the molecular formula C30H23IO
and a molecular weight of 526.42 g/mol. Its IUPAC name is (5Z)-5-[iodo(phenyl)methylidene]-2-methyl-2,3,4-triphenylfuran.
Molecular Properties
| Compound Name | (5Z)-5-[iodo(phenyl)methylidene]-2-methyl-2,3,4-triphenylfuran |
| PubChem CID | 11191718 |
| Molecular Formula | C30H23IO |
| Molecular Weight | 526.42 g/mol |
| Exact Mass | 526.08 |
| IUPAC Name | (5Z)-5-[iodo(phenyl)methylidene]-2-methyl-2,3,4-triphenylfuran |
| SMILES | CC1(c2ccccc2)O/C(=C(\I)c2ccccc2)C(c2ccccc2)=C1c1ccccc1 |
| InChI | InChI=1S/C30H23IO/c1-30(25-20-12-5-13-21-25)27(23-16-8-3-9-17-23)26(22-14-6-2-7-15-22)29(32-30)28(31)24-18-10-4-11-19-24/h2-21H,1H3/b29-28- |
| InChIKey | UKOBAQKQMCLJFL-ZIADKAODSA-N |
| XLogP | 8.35 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 526.42 |
| LogP ≤ 5 | 8.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze (5Z)-5-[iodo(phenyl)methylidene]-2-methyl-2,3,4-triphenylfuran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5Z)-5-[iodo(phenyl)methylidene]-2-methyl-2,3,4-triphenylfuran?
The IUPAC name of (5Z)-5-[iodo(phenyl)methylidene]-2-methyl-2,3,4-triphenylfuran (CID 11191718) is (5Z)-5-[iodo(phenyl)methylidene]-2-methyl-2,3,4-triphenylfuran.
What is the SMILES notation for (5Z)-5-[iodo(phenyl)methylidene]-2-methyl-2,3,4-triphenylfuran?
The canonical SMILES for (5Z)-5-[iodo(phenyl)methylidene]-2-methyl-2,3,4-triphenylfuran is CC1(c2ccccc2)O/C(=C(\I)c2ccccc2)C(c2ccccc2)=C1c1ccccc1.
What is the InChIKey of (5Z)-5-[iodo(phenyl)methylidene]-2-methyl-2,3,4-triphenylfuran?
The InChIKey is UKOBAQKQMCLJFL-ZIADKAODSA-N. The full InChI is InChI=1S/C30H23IO/c1-30(25-20-12-5-13-21-25)27(23-16-8-3-9-17-23)26(22-14-6-2-7-15-22)29(32-30)28(31)24-18-10-4-11-19-24/h2-21H,1H3/b29-28-.
What are the key properties of (5Z)-5-[iodo(phenyl)methylidene]-2-methyl-2,3,4-triphenylfuran?
(5Z)-5-[iodo(phenyl)methylidene]-2-methyl-2,3,4-triphenylfuran has a molecular weight of 526.42 g/mol, XLogP of 8.35, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (5Z)-5-[iodo(phenyl)methylidene]-2-methyl-2,3,4-triphenylfuran is sourced from PubChem (CID 11191718), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).