C23H23BrN4O6 — CID 11191803
3-[4-[5-[4-(4-bromophenoxy)phenyl]-2,4,6-trioxo-1,3-diazinan-5-yl]piperazin-1-yl]propanoic acid (PubChem CID 11191803) has the molecular formula C23H23BrN4O6 and a molecular weight of 531.36 g/mol. Its IUPAC name is 3-[4-[5-[4-(4-bromophenoxy)phenyl]-2,4,6-trioxo-1,3-diazinan-5-yl]piperazin-1-yl]propanoic acid.
| Compound Name | 3-[4-[5-[4-(4-bromophenoxy)phenyl]-2,4,6-trioxo-1,3-diazinan-5-yl]piperazin-1-yl]propanoic acid |
|---|---|
| PubChem CID | 11191803 |
| Molecular Formula | C23H23BrN4O6 |
| Molecular Weight | 531.36 g/mol |
| Exact Mass | 530.08 |
| IUPAC Name | 3-[4-[5-[4-(4-bromophenoxy)phenyl]-2,4,6-trioxo-1,3-diazinan-5-yl]piperazin-1-yl]propanoic acid |
| SMILES | O=C(O)CCN1CCN(C2(c3ccc(Oc4ccc(Br)cc4)cc3)C(=O)NC(=O)NC2=O)CC1 |
| InChI | InChI=1S/C23H23BrN4O6/c24-16-3-7-18(8-4-16)34-17-5-1-15(2-6-17)23(20(31)25-22(33)26-21(23)32)28-13-11-27(12-14-28)10-9-19(29)30/h1-8H,9-14H2,(H,29,30)(H2,25,26,31,32,33) |
| InChIKey | VQFRAJKJRLAZOI-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 128.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.36 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|