C31H52O5Si — CID 11191825
2-[(2R,3R)-3-[(1R,3R,3aR,7R,7aR)-4-methyl-3-prop-2-ynyl-7-[(2S)-1-tri(propan-2-yl)silyloxypropan-2-yl]-1,3,3a,6,7,7a-hexahydro-2-benzofuran-1-yl]-3-methyloxiran-2-yl]ethyl acetate (PubChem CID 11191825) has the molecular formula C31H52O5Si and a molecular weight of 532.84 g/mol. Its IUPAC name is 2-[(2R,3R)-3-[(1R,3R,3aR,7R,7aR)-4-methyl-3-prop-2-ynyl-7-[(2S)-1-tri(propan-2-yl)silyloxypropan-2-yl]-1,3,3a,6,7,7a-hexahydro-2-benzofuran-1-yl]-3-methyloxiran-2-yl]ethyl acetate.
| Compound Name | 2-[(2R,3R)-3-[(1R,3R,3aR,7R,7aR)-4-methyl-3-prop-2-ynyl-7-[(2S)-1-tri(propan-2-yl)silyloxypropan-2-yl]-1,3,3a,6,7,7a-hexahydro-2-benzofuran-1-yl]-3-methyloxiran-2-yl]ethyl acetate |
|---|---|
| PubChem CID | 11191825 |
| Molecular Formula | C31H52O5Si |
| Molecular Weight | 532.84 g/mol |
| Exact Mass | 532.36 |
| IUPAC Name | 2-[(2R,3R)-3-[(1R,3R,3aR,7R,7aR)-4-methyl-3-prop-2-ynyl-7-[(2S)-1-tri(propan-2-yl)silyloxypropan-2-yl]-1,3,3a,6,7,7a-hexahydro-2-benzofuran-1-yl]-3-methyloxiran-2-yl]ethyl acetate |
| SMILES | C#CC[C@H]1O[C@@H]([C@]2(C)O[C@@H]2CCOC(C)=O)[C@@H]2[C@@H]([C@H](C)CO[Si](C(C)C)(C(C)C)C(C)C)CC=C(C)[C@@H]21 |
| InChI | InChI=1S/C31H52O5Si/c1-12-13-26-28-22(8)14-15-25(23(9)18-34-37(19(2)3,20(4)5)21(6)7)29(28)30(35-26)31(11)27(36-31)16-17-33-24(10)32/h1,14,19-21,23,25-30H,13,15-18H2,2-11H3/t23-,25-,26-,27-,28-,29-,30-,31-/m1/s1 |
| InChIKey | JLVBZBKDVNLFAL-VLSDIJBESA-N |
| XLogP | 6.91 |
| TPSA | 57.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.84 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|