C23H38IN5O2 — CID 111918392
2-[3-[[[[(1-cyclopentylpyrrolidin-3-yl)amino]-(ethylamino)methylidene]amino]methyl]phenoxy]-N,N-dimethylacetamide;hydroiodide (PubChem CID 111918392) has the molecular formula C23H38IN5O2 and a molecular weight of 543.49 g/mol. Its IUPAC name is 2-[3-[[[[(1-cyclopentylpyrrolidin-3-yl)amino]-(ethylamino)methylidene]amino]methyl]phenoxy]-N,N-dimethylacetamide;hydroiodide.
| Compound Name | 2-[3-[[[[(1-cyclopentylpyrrolidin-3-yl)amino]-(ethylamino)methylidene]amino]methyl]phenoxy]-N,N-dimethylacetamide;hydroiodide |
|---|---|
| PubChem CID | 111918392 |
| Molecular Formula | C23H38IN5O2 |
| Molecular Weight | 543.49 g/mol |
| Exact Mass | 543.21 |
| IUPAC Name | 2-[3-[[[[(1-cyclopentylpyrrolidin-3-yl)amino]-(ethylamino)methylidene]amino]methyl]phenoxy]-N,N-dimethylacetamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1cccc(OCC(=O)N(C)C)c1)NC1CCN(C2CCCC2)C1.I |
| InChI | InChI=1S/C23H37N5O2.HI/c1-4-24-23(26-19-12-13-28(16-19)20-9-5-6-10-20)25-15-18-8-7-11-21(14-18)30-17-22(29)27(2)3;/h7-8,11,14,19-20H,4-6,9-10,12-13,15-17H2,1-3H3,(H2,24,25,26);1H |
| InChIKey | CEHIPLMWJVDFNF-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 69.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.49 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|