C22H29ClIN5O — CID 111923312
2-chloro-N-[2-[[N'-methyl-N-[1-(4-methylphenyl)pyrrolidin-3-yl]carbamimidoyl]amino]ethyl]benzamide;hydroiodide (PubChem CID 111923312) has the molecular formula C22H29ClIN5O and a molecular weight of 541.87 g/mol. Its IUPAC name is 2-chloro-N-[2-[[N'-methyl-N-[1-(4-methylphenyl)pyrrolidin-3-yl]carbamimidoyl]amino]ethyl]benzamide;hydroiodide.
| Compound Name | 2-chloro-N-[2-[[N'-methyl-N-[1-(4-methylphenyl)pyrrolidin-3-yl]carbamimidoyl]amino]ethyl]benzamide;hydroiodide |
|---|---|
| PubChem CID | 111923312 |
| Molecular Formula | C22H29ClIN5O |
| Molecular Weight | 541.87 g/mol |
| Exact Mass | 541.11 |
| IUPAC Name | 2-chloro-N-[2-[[N'-methyl-N-[1-(4-methylphenyl)pyrrolidin-3-yl]carbamimidoyl]amino]ethyl]benzamide;hydroiodide |
| SMILES | C/N=C(\NCCNC(=O)c1ccccc1Cl)NC1CCN(c2ccc(C)cc2)C1.I |
| InChI | InChI=1S/C22H28ClN5O.HI/c1-16-7-9-18(10-8-16)28-14-11-17(15-28)27-22(24-2)26-13-12-25-21(29)19-5-3-4-6-20(19)23;/h3-10,17H,11-15H2,1-2H3,(H,25,29)(H2,24,26,27);1H |
| InChIKey | BDEIZSDUSRYKRJ-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.87 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|