C26H37N5O — CID 111924053
1-ethyl-3-[1-(4-methylphenyl)pyrrolidin-3-yl]-2-[[4-(morpholin-4-ylmethyl)phenyl]methyl]guanidine (PubChem CID 111924053) has the molecular formula C26H37N5O and a molecular weight of 435.62 g/mol. Its IUPAC name is 1-ethyl-3-[1-(4-methylphenyl)pyrrolidin-3-yl]-2-[[4-(morpholin-4-ylmethyl)phenyl]methyl]guanidine.
| Compound Name | 1-ethyl-3-[1-(4-methylphenyl)pyrrolidin-3-yl]-2-[[4-(morpholin-4-ylmethyl)phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 111924053 |
| Molecular Formula | C26H37N5O |
| Molecular Weight | 435.62 g/mol |
| Exact Mass | 435.30 |
| IUPAC Name | 1-ethyl-3-[1-(4-methylphenyl)pyrrolidin-3-yl]-2-[[4-(morpholin-4-ylmethyl)phenyl]methyl]guanidine |
| SMILES | CCN/C(=N\Cc1ccc(CN2CCOCC2)cc1)NC1CCN(c2ccc(C)cc2)C1 |
| InChI | InChI=1S/C26H37N5O/c1-3-27-26(29-24-12-13-31(20-24)25-10-4-21(2)5-11-25)28-18-22-6-8-23(9-7-22)19-30-14-16-32-17-15-30/h4-11,24H,3,12-20H2,1-2H3,(H2,27,28,29) |
| InChIKey | LAAKXKMYBQCZQB-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 52.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.62 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|