C21H32N6O2 — CID 111924509
1-[1-(3,5-dimethoxyphenyl)pyrrolidin-3-yl]-2-methyl-3-(2-methyl-3-pyrazol-1-ylpropyl)guanidine (PubChem CID 111924509) has the molecular formula C21H32N6O2 and a molecular weight of 400.53 g/mol. Its IUPAC name is 1-[1-(3,5-dimethoxyphenyl)pyrrolidin-3-yl]-2-methyl-3-(2-methyl-3-pyrazol-1-ylpropyl)guanidine.
| Compound Name | 1-[1-(3,5-dimethoxyphenyl)pyrrolidin-3-yl]-2-methyl-3-(2-methyl-3-pyrazol-1-ylpropyl)guanidine |
|---|---|
| PubChem CID | 111924509 |
| Molecular Formula | C21H32N6O2 |
| Molecular Weight | 400.53 g/mol |
| Exact Mass | 400.26 |
| IUPAC Name | 1-[1-(3,5-dimethoxyphenyl)pyrrolidin-3-yl]-2-methyl-3-(2-methyl-3-pyrazol-1-ylpropyl)guanidine |
| SMILES | C/N=C(\NCC(C)Cn1cccn1)NC1CCN(c2cc(OC)cc(OC)c2)C1 |
| InChI | InChI=1S/C21H32N6O2/c1-16(14-27-8-5-7-24-27)13-23-21(22-2)25-17-6-9-26(15-17)18-10-19(28-3)12-20(11-18)29-4/h5,7-8,10-12,16-17H,6,9,13-15H2,1-4H3,(H2,22,23,25) |
| InChIKey | FWHROKZXZNHMKO-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 75.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.53 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|