C32H37Cl2N5O — CID 11192466
4-[[N-cyclohexyl-C-(4-phenylpiperazin-1-yl)carbonimidoyl]amino]-N-[2-(2,4-dichlorophenyl)ethyl]benzamide (PubChem CID 11192466) has the molecular formula C32H37Cl2N5O and a molecular weight of 578.59 g/mol. Its IUPAC name is 4-[[N-cyclohexyl-C-(4-phenylpiperazin-1-yl)carbonimidoyl]amino]-N-[2-(2,4-dichlorophenyl)ethyl]benzamide.
| Compound Name | 4-[[N-cyclohexyl-C-(4-phenylpiperazin-1-yl)carbonimidoyl]amino]-N-[2-(2,4-dichlorophenyl)ethyl]benzamide |
|---|---|
| PubChem CID | 11192466 |
| Molecular Formula | C32H37Cl2N5O |
| Molecular Weight | 578.59 g/mol |
| Exact Mass | 577.24 |
| IUPAC Name | 4-[[N-cyclohexyl-C-(4-phenylpiperazin-1-yl)carbonimidoyl]amino]-N-[2-(2,4-dichlorophenyl)ethyl]benzamide |
| SMILES | O=C(NCCc1ccc(Cl)cc1Cl)c1ccc(N/C(=N/C2CCCCC2)N2CCN(c3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C32H37Cl2N5O/c33-26-14-11-24(30(34)23-26)17-18-35-31(40)25-12-15-28(16-13-25)37-32(36-27-7-3-1-4-8-27)39-21-19-38(20-22-39)29-9-5-2-6-10-29/h2,5-6,9-16,23,27H,1,3-4,7-8,17-22H2,(H,35,40)(H,36,37) |
| InChIKey | XMUPUYAWRNUGJZ-UHFFFAOYSA-N |
| XLogP | 6.89 |
| TPSA | 59.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.59 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|